C18H29NO9 — CID 132577383
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)acetic acid (PubChem CID 132577383) has the molecular formula C18H29NO9 and a molecular weight of 403.43 g/mol. Its IUPAC name is (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)acetic acid.
| Compound Name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)acetic acid |
|---|---|
| PubChem CID | 132577383 |
| Molecular Formula | C18H29NO9 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)acetic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C(=O)O)C1OC2OC(C)(C)OC2C2OC(C)(C)OC21 |
| InChI | InChI=1S/C18H29NO9/c1-16(2,3)28-15(22)19-8(13(20)21)9-10-11(25-17(4,5)24-10)12-14(23-9)27-18(6,7)26-12/h8-12,14H,1-7H3,(H,19,22)(H,20,21)/t8-,9?,10?,11?,12?,14?/m1/s1 |
| InChIKey | BDVJOLKGTVPLLC-HQSYEPAASA-N |
| XLogP | 1.36 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |