C17H29NO8 — CID 132516469
(2S)-2-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (PubChem CID 132516469) has the molecular formula C17H29NO8 and a molecular weight of 375.42 g/mol. Its IUPAC name is (2S)-2-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid.
| Compound Name | (2S)-2-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
|---|---|
| PubChem CID | 132516469 |
| Molecular Formula | C17H29NO8 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | (2S)-2-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)O)[C@H]1OC(C)(C)O[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C17H29NO8/c1-15(2,3)26-14(21)18-10(13(19)20)12-11(24-17(6,7)25-12)9-8-22-16(4,5)23-9/h9-12H,8H2,1-7H3,(H,18,21)(H,19,20)/t9-,10+,11-,12-/m1/s1 |
| InChIKey | XMPKXINSECVRKI-WRWGMCAJSA-N |
| XLogP | 1.64 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |