C16H29NO7 — CID 101026431
tert-butyl N-[[(2S,3S,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]carbamate (PubChem CID 101026431) has the molecular formula C16H29NO7 and a molecular weight of 347.41 g/mol. Its IUPAC name is tert-butyl N-[[(2S,3S,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(2S,3S,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 101026431 |
| Molecular Formula | C16H29NO7 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | tert-butyl N-[[(2S,3S,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]carbamate |
| SMILES | C[C@H]1O[C@@H](C(NC(=O)OC(C)(C)C)[C@H]2COC(C)(C)O2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H29NO7/c1-8-11(18)12(19)13(22-8)10(9-7-21-16(5,6)23-9)17-14(20)24-15(2,3)4/h8-13,18-19H,7H2,1-6H3,(H,17,20)/t8-,9-,10?,11-,12+,13+/m1/s1 |
| InChIKey | XUFAYMVWULFALT-ZTQRRVRNSA-N |
| XLogP | 0.54 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |