C15H26O4 — CID 90334062
tert-butyl (2S,3S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpent-4-enoate (PubChem CID 90334062) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is tert-butyl (2S,3S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpent-4-enoate.
| Compound Name | tert-butyl (2S,3S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpent-4-enoate |
|---|---|
| PubChem CID | 90334062 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | tert-butyl (2S,3S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpent-4-enoate |
| SMILES | C=C[C@H]([C@@H]1COC(C)(C)O1)[C@H](C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H26O4/c1-8-11(12-9-17-15(6,7)18-12)10(2)13(16)19-14(3,4)5/h8,10-12H,1,9H2,2-7H3/t10-,11-,12-/m0/s1 |
| InChIKey | IPMQSOUMHMBBBN-SRVKXCTJSA-N |
| XLogP | 2.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|