C15H26O5 — CID 86705860
tert-butyl (2S,3R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxypent-4-enoate (PubChem CID 86705860) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is tert-butyl (2S,3R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxypent-4-enoate.
| Compound Name | tert-butyl (2S,3R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxypent-4-enoate |
|---|---|
| PubChem CID | 86705860 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | tert-butyl (2S,3R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxypent-4-enoate |
| SMILES | C=C[C@H]([C@@H]1COC(C)(C)O1)[C@H](OC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H26O5/c1-8-10(11-9-18-15(5,6)19-11)12(17-7)13(16)20-14(2,3)4/h8,10-12H,1,9H2,2-7H3/t10-,11+,12+/m1/s1 |
| InChIKey | LRTWLZIWFICMME-WOPDTQHZSA-N |
| XLogP | 2.30 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|