C17H30Cl3NO4Si — CID 132559996
N-[(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-en-2-yl]-2,2,2-trichloroacetamide (PubChem CID 132559996) has the molecular formula C17H30Cl3NO4Si and a molecular weight of 446.88 g/mol. Its IUPAC name is N-[(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-en-2-yl]-2,2,2-trichloroacetamide.
| Compound Name | N-[(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-en-2-yl]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 132559996 |
| Molecular Formula | C17H30Cl3NO4Si |
| Molecular Weight | 446.88 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | N-[(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-en-2-yl]-2,2,2-trichloroacetamide |
| SMILES | C=C[C@H](NC(=O)C(Cl)(Cl)Cl)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C17H30Cl3NO4Si/c1-9-11(21-14(22)17(18,19)20)13(12-10-23-16(5,6)24-12)25-26(7,8)15(2,3)4/h9,11-13H,1,10H2,2-8H3,(H,21,22)/t11-,12-,13-/m0/s1 |
| InChIKey | QFFZAPRMYZLYSA-AVGNSLFASA-N |
| XLogP | 4.57 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.88 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|