C11H21NO4 — CID 68605714
tert-butyl N-(2,2-dimethyl-1,3-dioxan-5-yl)carbamate (PubChem CID 68605714) has the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. Its IUPAC name is tert-butyl N-(2,2-dimethyl-1,3-dioxan-5-yl)carbamate.
| Compound Name | tert-butyl N-(2,2-dimethyl-1,3-dioxan-5-yl)carbamate |
|---|---|
| PubChem CID | 68605714 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | tert-butyl N-(2,2-dimethyl-1,3-dioxan-5-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1COC(C)(C)OC1 |
| InChI | InChI=1S/C11H21NO4/c1-10(2,3)16-9(13)12-8-6-14-11(4,5)15-7-8/h8H,6-7H2,1-5H3,(H,12,13) |
| InChIKey | LDUSAWTYDYFOKP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |