C10H20N2O2 — CID 71280569
tert-butyl N-(3-amino-3-methylcyclobutyl)carbamate (PubChem CID 71280569) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is tert-butyl N-(3-amino-3-methylcyclobutyl)carbamate.
| Compound Name | tert-butyl N-(3-amino-3-methylcyclobutyl)carbamate |
|---|---|
| PubChem CID | 71280569 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | tert-butyl N-(3-amino-3-methylcyclobutyl)carbamate |
| SMILES | CC1(N)CC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C10H20N2O2/c1-9(2,3)14-8(13)12-7-5-10(4,11)6-7/h7H,5-6,11H2,1-4H3,(H,12,13) |
| InChIKey | IDZXBLNHGNNOSO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |