C11H15F2NO4 — CID 155092613
tert-butyl N-(3,3-dicarbonofluoridoylcyclobutyl)carbamate (PubChem CID 155092613) has the molecular formula C11H15F2NO4 and a molecular weight of 263.24 g/mol. Its IUPAC name is tert-butyl N-(3,3-dicarbonofluoridoylcyclobutyl)carbamate.
| Compound Name | tert-butyl N-(3,3-dicarbonofluoridoylcyclobutyl)carbamate |
|---|---|
| PubChem CID | 155092613 |
| Molecular Formula | C11H15F2NO4 |
| Molecular Weight | 263.24 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | tert-butyl N-(3,3-dicarbonofluoridoylcyclobutyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC(C(=O)F)(C(=O)F)C1 |
| InChI | InChI=1S/C11H15F2NO4/c1-10(2,3)18-9(17)14-6-4-11(5-6,7(12)15)8(13)16/h6H,4-5H2,1-3H3,(H,14,17) |
| InChIKey | WFEXUVHIQXDSCV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|