C12H23ClN2O2 — CID 146082168
tert-butyl N-(6-aminospiro[3.3]heptan-2-yl)carbamate;hydrochloride (PubChem CID 146082168) has the molecular formula C12H23ClN2O2 and a molecular weight of 262.78 g/mol. Its IUPAC name is tert-butyl N-(6-aminospiro[3.3]heptan-2-yl)carbamate;hydrochloride.
| Compound Name | tert-butyl N-(6-aminospiro[3.3]heptan-2-yl)carbamate;hydrochloride |
|---|---|
| PubChem CID | 146082168 |
| Molecular Formula | C12H23ClN2O2 |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | tert-butyl N-(6-aminospiro[3.3]heptan-2-yl)carbamate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)NC1CC2(CC(N)C2)C1.Cl |
| InChI | InChI=1S/C12H22N2O2.ClH/c1-11(2,3)16-10(15)14-9-6-12(7-9)4-8(13)5-12;/h8-9H,4-7,13H2,1-3H3,(H,14,15);1H |
| InChIKey | WFOYWFRNEOROEZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |