C20H36O6 — CID 25140842
[(2R)-2-[(4R,5S,6S)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propyl] 2,2-dimethylpropanoate (PubChem CID 25140842) has the molecular formula C20H36O6 and a molecular weight of 372.50 g/mol. Its IUPAC name is [(2R)-2-[(4R,5S,6S)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R)-2-[(4R,5S,6S)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 25140842 |
| Molecular Formula | C20H36O6 |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | [(2R)-2-[(4R,5S,6S)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propyl] 2,2-dimethylpropanoate |
| SMILES | C[C@H]1[C@@H]([C@H](C)COC(=O)C(C)(C)C)OC(C)(C)O[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C20H36O6/c1-12(10-22-17(21)18(3,4)5)15-13(2)16(26-20(8,9)25-15)14-11-23-19(6,7)24-14/h12-16H,10-11H2,1-9H3/t12-,13+,14-,15-,16+/m1/s1 |
| InChIKey | NTLDWNZALFUMAT-JKJDWNRSSA-N |
| XLogP | 3.52 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |