C21H38O6 — CID 10620195
[(2R)-2-[(4R,5S,6S)-2,2,5-trimethyl-6-[(1R)-1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]ethyl]-1,3-dioxan-4-yl]propyl] acetate (PubChem CID 10620195) has the molecular formula C21H38O6 and a molecular weight of 386.53 g/mol. Its IUPAC name is [(2R)-2-[(4R,5S,6S)-2,2,5-trimethyl-6-[(1R)-1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]ethyl]-1,3-dioxan-4-yl]propyl] acetate.
| Compound Name | [(2R)-2-[(4R,5S,6S)-2,2,5-trimethyl-6-[(1R)-1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]ethyl]-1,3-dioxan-4-yl]propyl] acetate |
|---|---|
| PubChem CID | 10620195 |
| Molecular Formula | C21H38O6 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | [(2R)-2-[(4R,5S,6S)-2,2,5-trimethyl-6-[(1R)-1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]ethyl]-1,3-dioxan-4-yl]propyl] acetate |
| SMILES | CC(=O)OC[C@@H](C)[C@H]1OC(C)(C)O[C@H]([C@H](C)[C@H]2OC(C)(C)OC[C@@H]2C)[C@H]1C |
| InChI | InChI=1S/C21H38O6/c1-12(10-23-16(5)22)17-14(3)19(27-21(8,9)26-17)15(4)18-13(2)11-24-20(6,7)25-18/h12-15,17-19H,10-11H2,1-9H3/t12-,13+,14+,15-,17-,18+,19+/m1/s1 |
| InChIKey | VQGVJIWGTGWQQA-KUPDVBAFSA-N |
| XLogP | 3.77 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |