C13H24O3 — CID 134878956
(5R)-2,2,5-trimethyl-4-[(2S)-4-(oxiran-2-yl)butan-2-yl]-1,3-dioxane (PubChem CID 134878956) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is (5R)-2,2,5-trimethyl-4-[(2S)-4-(oxiran-2-yl)butan-2-yl]-1,3-dioxane.
| Compound Name | (5R)-2,2,5-trimethyl-4-[(2S)-4-(oxiran-2-yl)butan-2-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 134878956 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | (5R)-2,2,5-trimethyl-4-[(2S)-4-(oxiran-2-yl)butan-2-yl]-1,3-dioxane |
| SMILES | C[C@@H]1COC(C)(C)OC1[C@@H](C)CCC1CO1 |
| InChI | InChI=1S/C13H24O3/c1-9(5-6-11-8-14-11)12-10(2)7-15-13(3,4)16-12/h9-12H,5-8H2,1-4H3/t9-,10+,11?,12?/m0/s1 |
| InChIKey | UFRVPDWFHIQCMW-DMOGRIERSA-N |
| XLogP | 2.59 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|