C15H29NO4 — CID 25140404
(2R,3R,4R)-3-hydroxy-N,N,2-trimethyl-4-[(4R,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]pentanamide (PubChem CID 25140404) has the molecular formula C15H29NO4 and a molecular weight of 287.40 g/mol. Its IUPAC name is (2R,3R,4R)-3-hydroxy-N,N,2-trimethyl-4-[(4R,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]pentanamide.
| Compound Name | (2R,3R,4R)-3-hydroxy-N,N,2-trimethyl-4-[(4R,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]pentanamide |
|---|---|
| PubChem CID | 25140404 |
| Molecular Formula | C15H29NO4 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | (2R,3R,4R)-3-hydroxy-N,N,2-trimethyl-4-[(4R,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]pentanamide |
| SMILES | C[C@H]([C@@H](O)[C@@H](C)C(=O)N(C)C)[C@@H]1OC(C)(C)OC[C@H]1C |
| InChI | InChI=1S/C15H29NO4/c1-9-8-19-15(4,5)20-13(9)10(2)12(17)11(3)14(18)16(6)7/h9-13,17H,8H2,1-7H3/t9-,10-,11-,12-,13-/m1/s1 |
| InChIKey | YEMKDCQDOOMLJC-SYLRKERUSA-N |
| XLogP | 1.50 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |