C20H30O3 — CID 10448601
(4S,5S)-2,2,5-trimethyl-4-[(2R,3S)-4-methyl-3-phenylmethoxypent-4-en-2-yl]-1,3-dioxane (PubChem CID 10448601) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (4S,5S)-2,2,5-trimethyl-4-[(2R,3S)-4-methyl-3-phenylmethoxypent-4-en-2-yl]-1,3-dioxane.
| Compound Name | (4S,5S)-2,2,5-trimethyl-4-[(2R,3S)-4-methyl-3-phenylmethoxypent-4-en-2-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 10448601 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (4S,5S)-2,2,5-trimethyl-4-[(2R,3S)-4-methyl-3-phenylmethoxypent-4-en-2-yl]-1,3-dioxane |
| SMILES | C=C(C)[C@@H](OCc1ccccc1)[C@H](C)[C@H]1OC(C)(C)OC[C@@H]1C |
| InChI | InChI=1S/C20H30O3/c1-14(2)18(21-13-17-10-8-7-9-11-17)16(4)19-15(3)12-22-20(5,6)23-19/h7-11,15-16,18-19H,1,12-13H2,2-6H3/t15-,16-,18+,19-/m0/s1 |
| InChIKey | RNTZJCLAVYWRRI-DKKFBQAASA-N |
| XLogP | 4.57 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|