C18H26O3 — CID 10661190
(4S)-2,2-dimethyl-4-[(2R,3S)-3-methyl-2-phenylmethoxypent-4-enyl]-1,3-dioxolane (PubChem CID 10661190) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is (4S)-2,2-dimethyl-4-[(2R,3S)-3-methyl-2-phenylmethoxypent-4-enyl]-1,3-dioxolane.
| Compound Name | (4S)-2,2-dimethyl-4-[(2R,3S)-3-methyl-2-phenylmethoxypent-4-enyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 10661190 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (4S)-2,2-dimethyl-4-[(2R,3S)-3-methyl-2-phenylmethoxypent-4-enyl]-1,3-dioxolane |
| SMILES | C=C[C@H](C)[C@@H](C[C@H]1COC(C)(C)O1)OCc1ccccc1 |
| InChI | InChI=1S/C18H26O3/c1-5-14(2)17(11-16-13-20-18(3,4)21-16)19-12-15-9-7-6-8-10-15/h5-10,14,16-17H,1,11-13H2,2-4H3/t14-,16-,17+/m0/s1 |
| InChIKey | YRMBNZLOOFPESJ-BHYGNILZSA-N |
| XLogP | 3.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|