C24H31NO2 — CID 102426126
(1S,2R)-N,N-dibenzyl-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylbut-3-en-1-amine (PubChem CID 102426126) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is (1S,2R)-N,N-dibenzyl-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylbut-3-en-1-amine.
| Compound Name | (1S,2R)-N,N-dibenzyl-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylbut-3-en-1-amine |
|---|---|
| PubChem CID | 102426126 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | (1S,2R)-N,N-dibenzyl-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylbut-3-en-1-amine |
| SMILES | C=C[C@@H](C)[C@@H]([C@@H]1COC(C)(C)O1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H31NO2/c1-5-19(2)23(22-18-26-24(3,4)27-22)25(16-20-12-8-6-9-13-20)17-21-14-10-7-11-15-21/h5-15,19,22-23H,1,16-18H2,2-4H3/t19-,22+,23+/m1/s1 |
| InChIKey | WALDDHUUHBQHAR-OIBXWCBGSA-N |
| XLogP | 5.03 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|