C23H30O8 — CID 54327458
(1S)-1-[(4R,5R)-5-[(1S)-1,2-dihydroxy-2-phenylmethoxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylmethoxyethane-1,2-diol (PubChem CID 54327458) has the molecular formula C23H30O8 and a molecular weight of 434.49 g/mol. Its IUPAC name is (1S)-1-[(4R,5R)-5-[(1S)-1,2-dihydroxy-2-phenylmethoxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylmethoxyethane-1,2-diol.
| Compound Name | (1S)-1-[(4R,5R)-5-[(1S)-1,2-dihydroxy-2-phenylmethoxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylmethoxyethane-1,2-diol |
|---|---|
| PubChem CID | 54327458 |
| Molecular Formula | C23H30O8 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | (1S)-1-[(4R,5R)-5-[(1S)-1,2-dihydroxy-2-phenylmethoxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylmethoxyethane-1,2-diol |
| SMILES | CC1(C)O[C@H]([C@H](O)C(O)OCc2ccccc2)[C@@H]([C@H](O)C(O)OCc2ccccc2)O1 |
| InChI | InChI=1S/C23H30O8/c1-23(2)30-19(17(24)21(26)28-13-15-9-5-3-6-10-15)20(31-23)18(25)22(27)29-14-16-11-7-4-8-12-16/h3-12,17-22,24-27H,13-14H2,1-2H3/t17-,18-,19+,20+,21?,22?/m0/s1 |
| InChIKey | SVYZSUNKURYVHA-KCNMUOTRSA-N |
| XLogP | 1.30 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|