C19H29NO7 — CID 10992603
benzyl N-[(1R)-1-[(4R,5S)-5-[(1R)-1-hydroxy-2,2-dimethoxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]carbamate (PubChem CID 10992603) has the molecular formula C19H29NO7 and a molecular weight of 383.44 g/mol. Its IUPAC name is benzyl N-[(1R)-1-[(4R,5S)-5-[(1R)-1-hydroxy-2,2-dimethoxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]carbamate.
| Compound Name | benzyl N-[(1R)-1-[(4R,5S)-5-[(1R)-1-hydroxy-2,2-dimethoxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 10992603 |
| Molecular Formula | C19H29NO7 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | benzyl N-[(1R)-1-[(4R,5S)-5-[(1R)-1-hydroxy-2,2-dimethoxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]carbamate |
| SMILES | COC(OC)[C@H](O)[C@@H]1OC(C)(C)O[C@@H]1[C@@H](C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H29NO7/c1-12(20-18(22)25-11-13-9-7-6-8-10-13)15-16(27-19(2,3)26-15)14(21)17(23-4)24-5/h6-10,12,14-17,21H,11H2,1-5H3,(H,20,22)/t12-,14-,15-,16+/m1/s1 |
| InChIKey | XZEQQOJWSMTZJT-MIGQKNRLSA-N |
| XLogP | 1.80 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|