C21H29NO9 — CID 20759893
ethyl 3-hydroxy-3-(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 20759893) has the molecular formula C21H29NO9 and a molecular weight of 439.46 g/mol. Its IUPAC name is ethyl 3-hydroxy-3-(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | ethyl 3-hydroxy-3-(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 20759893 |
| Molecular Formula | C21H29NO9 |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | ethyl 3-hydroxy-3-(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | CCOC(=O)C(NC(=O)OCc1ccccc1)C(O)C1OC(OC)C2OC(C)(C)OC21 |
| InChI | InChI=1S/C21H29NO9/c1-5-27-18(24)13(22-20(25)28-11-12-9-7-6-8-10-12)14(23)15-16-17(19(26-4)29-15)31-21(2,3)30-16/h6-10,13-17,19,23H,5,11H2,1-4H3,(H,22,25) |
| InChIKey | WYIYDYQFELWQLI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |