C17H22N2O7 — CID 22992070
benzyl N-[(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl)amino]carbamate (PubChem CID 22992070) has the molecular formula C17H22N2O7 and a molecular weight of 366.37 g/mol. Its IUPAC name is benzyl N-[(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl)amino]carbamate.
| Compound Name | benzyl N-[(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl)amino]carbamate |
|---|---|
| PubChem CID | 22992070 |
| Molecular Formula | C17H22N2O7 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | benzyl N-[(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl)amino]carbamate |
| SMILES | COC1OC(C(=O)NNC(=O)OCc2ccccc2)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C17H22N2O7/c1-17(2)25-11-12(24-15(22-3)13(11)26-17)14(20)18-19-16(21)23-9-10-7-5-4-6-8-10/h4-8,11-13,15H,9H2,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | KZVKYEGETXVCFF-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|