C11H19NO5 — CID 15539710
(3aR,4R,6S,6aS)-N-ethyl-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide (PubChem CID 15539710) has the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. Its IUPAC name is (3aR,4R,6S,6aS)-N-ethyl-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide.
| Compound Name | (3aR,4R,6S,6aS)-N-ethyl-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide |
|---|---|
| PubChem CID | 15539710 |
| Molecular Formula | C11H19NO5 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | (3aR,4R,6S,6aS)-N-ethyl-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](OC)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C11H19NO5/c1-5-12-9(13)7-6-8(10(14-4)15-7)17-11(2,3)16-6/h6-8,10H,5H2,1-4H3,(H,12,13)/t6-,7+,8-,10-/m1/s1 |
| InChIKey | XAIZUKJPTCMOII-IBCQBUCCSA-N |
| XLogP | 0.01 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |