C14H21NO8 — CID 3146275
2-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl)amino]acetic acid (PubChem CID 3146275) has the molecular formula C14H21NO8 and a molecular weight of 331.32 g/mol. Its IUPAC name is 2-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl)amino]acetic acid.
| Compound Name | 2-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 3146275 |
| Molecular Formula | C14H21NO8 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 2-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl)amino]acetic acid |
| SMILES | CC1(C)OC2OC(C(=O)NCC(=O)O)C3OC(C)(C)OC3C2O1 |
| InChI | InChI=1S/C14H21NO8/c1-13(2)20-7-8(21-13)10-12(23-14(3,4)22-10)19-9(7)11(18)15-5-6(16)17/h7-10,12H,5H2,1-4H3,(H,15,18)(H,16,17) |
| InChIKey | GGSFFXKXAVNAID-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |