C15H25NO7 — CID 3123174
N-(3-hydroxypropyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide (PubChem CID 3123174) has the molecular formula C15H25NO7 and a molecular weight of 331.37 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide.
| Compound Name | N-(3-hydroxypropyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
|---|---|
| PubChem CID | 3123174 |
| Molecular Formula | C15H25NO7 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | N-(3-hydroxypropyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
| SMILES | CC1(C)OC2OC(C(=O)NCCCO)C3OC(C)(C)OC3C2O1 |
| InChI | InChI=1S/C15H25NO7/c1-14(2)20-8-9(21-14)11-13(23-15(3,4)22-11)19-10(8)12(18)16-6-5-7-17/h8-11,13,17H,5-7H2,1-4H3,(H,16,18) |
| InChIKey | CDBBCNYRIPMPAE-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|