C14H22N2O7 — CID 124776090
(1S,2R,6S,8S,9R)-N-(2-amino-2-oxoethyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide (PubChem CID 124776090) has the molecular formula C14H22N2O7 and a molecular weight of 330.34 g/mol. Its IUPAC name is (1S,2R,6S,8S,9R)-N-(2-amino-2-oxoethyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide.
| Compound Name | (1S,2R,6S,8S,9R)-N-(2-amino-2-oxoethyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
|---|---|
| PubChem CID | 124776090 |
| Molecular Formula | C14H22N2O7 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | (1S,2R,6S,8S,9R)-N-(2-amino-2-oxoethyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](C(=O)NCC(N)=O)O[C@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C14H22N2O7/c1-13(2)20-7-8(21-13)10-12(23-14(3,4)22-10)19-9(7)11(18)16-5-6(15)17/h7-10,12H,5H2,1-4H3,(H2,15,17)(H,16,18)/t7-,8+,9+,10-,12+/m1/s1 |
| InChIKey | ZNMJIWKPLYNJEA-LNGZZDABSA-N |
| XLogP | -1.02 |
| TPSA | 118.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |