C15H22NO8- — CID 11906179
3-[[(1R,2R,6S,8R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl]amino]propanoate (PubChem CID 11906179) has the molecular formula C15H22NO8- and a molecular weight of 344.34 g/mol. Its IUPAC name is 3-[[(1R,2R,6S,8R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl]amino]propanoate.
| Compound Name | 3-[[(1R,2R,6S,8R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 11906179 |
| Molecular Formula | C15H22NO8- |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 3-[[(1R,2R,6S,8R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl]amino]propanoate |
| SMILES | CC1(C)O[C@@H]2[C@@H](O1)[C@H](C(=O)NCCC(=O)[O-])O[C@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C15H23NO8/c1-14(2)21-8-9(22-14)11-13(24-15(3,4)23-11)20-10(8)12(19)16-6-5-7(17)18/h8-11,13H,5-6H2,1-4H3,(H,16,19)(H,17,18)/p-1/t8-,9-,10-,11-,13+/m1/s1 |
| InChIKey | SOJLRQMEBKAZHB-CJJWORHMSA-M |
| XLogP | -1.36 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |