C15H22NO8- — CID 7370985
(2S)-2-[[(1S,2R,6S,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl]amino]propanoate (PubChem CID 7370985) has the molecular formula C15H22NO8- and a molecular weight of 344.34 g/mol. Its IUPAC name is (2S)-2-[[(1S,2R,6S,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl]amino]propanoate.
| Compound Name | (2S)-2-[[(1S,2R,6S,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 7370985 |
| Molecular Formula | C15H22NO8- |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | (2S)-2-[[(1S,2R,6S,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl]amino]propanoate |
| SMILES | C[C@H](NC(=O)[C@H]1O[C@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@@H]21)C(=O)[O-] |
| InChI | InChI=1S/C15H23NO8/c1-6(12(18)19)16-11(17)9-7-8(22-14(2,3)21-7)10-13(20-9)24-15(4,5)23-10/h6-10,13H,1-5H3,(H,16,17)(H,18,19)/p-1/t6-,7-,8-,9-,10+,13-/m0/s1 |
| InChIKey | FHLRNMBOHDMUAS-PROHFVSBSA-M |
| XLogP | -1.36 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |