C24H32N2O9 — CID 163072284
ethyl 4-[[(2R)-2-[[(1S,2S,6R,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl]amino]propanoyl]amino]benzoate (PubChem CID 163072284) has the molecular formula C24H32N2O9 and a molecular weight of 492.53 g/mol. Its IUPAC name is ethyl 4-[[(2R)-2-[[(1S,2S,6R,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl]amino]propanoyl]amino]benzoate.
| Compound Name | ethyl 4-[[(2R)-2-[[(1S,2S,6R,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl]amino]propanoyl]amino]benzoate |
|---|---|
| PubChem CID | 163072284 |
| Molecular Formula | C24H32N2O9 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | ethyl 4-[[(2R)-2-[[(1S,2S,6R,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl]amino]propanoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)[C@@H](C)NC(=O)[C@H]2O[C@@H]3OC(C)(C)O[C@H]3[C@H]3OC(C)(C)O[C@@H]32)cc1 |
| InChI | InChI=1S/C24H32N2O9/c1-7-30-21(29)13-8-10-14(11-9-13)26-19(27)12(2)25-20(28)17-15-16(33-23(3,4)32-15)18-22(31-17)35-24(5,6)34-18/h8-12,15-18,22H,7H2,1-6H3,(H,25,28)(H,26,27)/t12-,15+,16+,17+,18+,22-/m1/s1 |
| InChIKey | QYQWWRVZUNYMAM-ZJPZCOQJSA-N |
| XLogP | 1.70 |
| TPSA | 130.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |