C18H24N2O8S — CID 124746173
(1R,2S,6S,8S,9R)-4,4,11,11-tetramethyl-N-(4-sulfamoylphenyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide (PubChem CID 124746173) has the molecular formula C18H24N2O8S and a molecular weight of 428.46 g/mol. Its IUPAC name is (1R,2S,6S,8S,9R)-4,4,11,11-tetramethyl-N-(4-sulfamoylphenyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide.
| Compound Name | (1R,2S,6S,8S,9R)-4,4,11,11-tetramethyl-N-(4-sulfamoylphenyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
|---|---|
| PubChem CID | 124746173 |
| Molecular Formula | C18H24N2O8S |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | (1R,2S,6S,8S,9R)-4,4,11,11-tetramethyl-N-(4-sulfamoylphenyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
| SMILES | CC1(C)O[C@@H]2O[C@H](C(=O)Nc3ccc(S(N)(=O)=O)cc3)[C@@H]3OC(C)(C)O[C@H]3[C@@H]2O1 |
| InChI | InChI=1S/C18H24N2O8S/c1-17(2)25-11-12(26-17)14-16(28-18(3,4)27-14)24-13(11)15(21)20-9-5-7-10(8-6-9)29(19,22)23/h5-8,11-14,16H,1-4H3,(H,20,21)(H2,19,22,23)/t11-,12-,13+,14+,16+/m1/s1 |
| InChIKey | KOGJTKKRHBGYHM-NJURLYQPSA-N |
| XLogP | 0.67 |
| TPSA | 135.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |