C20H28N2O9S — CID 92848488
N-(4-sulfamoylphenyl)-2-[[(1S,2S,6S,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]acetamide (PubChem CID 92848488) has the molecular formula C20H28N2O9S and a molecular weight of 472.52 g/mol. Its IUPAC name is N-(4-sulfamoylphenyl)-2-[[(1S,2S,6S,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]acetamide.
| Compound Name | N-(4-sulfamoylphenyl)-2-[[(1S,2S,6S,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]acetamide |
|---|---|
| PubChem CID | 92848488 |
| Molecular Formula | C20H28N2O9S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | N-(4-sulfamoylphenyl)-2-[[(1S,2S,6S,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]acetamide |
| SMILES | CC1(C)O[C@@H]2O[C@H](COCC(=O)Nc3ccc(S(N)(=O)=O)cc3)[C@@H]3OC(C)(C)O[C@@H]3[C@@H]2O1 |
| InChI | InChI=1S/C20H28N2O9S/c1-19(2)28-15-13(27-18-17(16(15)29-19)30-20(3,4)31-18)9-26-10-14(23)22-11-5-7-12(8-6-11)32(21,24)25/h5-8,13,15-18H,9-10H2,1-4H3,(H,22,23)(H2,21,24,25)/t13-,15+,16+,17+,18+/m1/s1 |
| InChIKey | ULNYTOXMXIRIJT-QSGXVVIFSA-N |
| XLogP | 0.69 |
| TPSA | 144.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |