C13H22O8P+ — CID 177385254
methoxy-oxo-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]phosphanium (PubChem CID 177385254) has the molecular formula C13H22O8P+ and a molecular weight of 337.29 g/mol. Its IUPAC name is methoxy-oxo-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]phosphanium.
| Compound Name | methoxy-oxo-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]phosphanium |
|---|---|
| PubChem CID | 177385254 |
| Molecular Formula | C13H22O8P+ |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | methoxy-oxo-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]phosphanium |
| SMILES | CO[P+](=O)OC[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C13H22O8P/c1-12(2)18-8-7(6-16-22(14)15-5)17-11-10(9(8)19-12)20-13(3,4)21-11/h7-11H,6H2,1-5H3/q+1/t7-,8+,9+,10-,11-/m1/s1 |
| InChIKey | FPTQAMRCMYTKBP-ZKKRXERASA-N |
| XLogP | 1.70 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|