C27H44O13 — CID 102472736
1,3-bis[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]propan-2-ol (PubChem CID 102472736) has the molecular formula C27H44O13 and a molecular weight of 576.64 g/mol. Its IUPAC name is 1,3-bis[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]propan-2-ol.
| Compound Name | 1,3-bis[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]propan-2-ol |
|---|---|
| PubChem CID | 102472736 |
| Molecular Formula | C27H44O13 |
| Molecular Weight | 576.64 g/mol |
| Exact Mass | 576.28 |
| IUPAC Name | 1,3-bis[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]propan-2-ol |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](COCC(O)COC[C@H]1O[C@@H]3OC(C)(C)O[C@@H]3[C@H]3OC(C)(C)O[C@H]31)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C27H44O13/c1-24(2)33-16-14(31-22-20(18(16)35-24)37-26(5,6)39-22)11-29-9-13(28)10-30-12-15-17-19(36-25(3,4)34-17)21-23(32-15)40-27(7,8)38-21/h13-23,28H,9-12H2,1-8H3/t14-,15-,16+,17+,18+,19+,20-,21-,22-,23-/m1/s1 |
| InChIKey | CXBFCEJJPQCDQW-XGLSNRBDSA-N |
| XLogP | 1.17 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.64 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |