C17H30O6 — CID 100509606
(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-8-(3-methylbutoxymethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 100509606) has the molecular formula C17H30O6 and a molecular weight of 330.42 g/mol. Its IUPAC name is (1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-8-(3-methylbutoxymethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-8-(3-methylbutoxymethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 100509606 |
| Molecular Formula | C17H30O6 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | (1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-8-(3-methylbutoxymethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | CC(C)CCOC[C@@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C17H30O6/c1-10(2)7-8-18-9-11-12-13(21-16(3,4)20-12)14-15(19-11)23-17(5,6)22-14/h10-15H,7-9H2,1-6H3/t11-,12+,13-,14+,15+/m0/s1 |
| InChIKey | QHOMIWJHYCVKGM-XPABHHOTSA-N |
| XLogP | 2.45 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|