C16H27IO6 — CID 135016588
(6R,9S)-8-(4-iodobutoxymethyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 135016588) has the molecular formula C16H27IO6 and a molecular weight of 442.29 g/mol. Its IUPAC name is (6R,9S)-8-(4-iodobutoxymethyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (6R,9S)-8-(4-iodobutoxymethyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 135016588 |
| Molecular Formula | C16H27IO6 |
| Molecular Weight | 442.29 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | (6R,9S)-8-(4-iodobutoxymethyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | CC1(C)OC2C3OC(C)(C)O[C@H]3C(COCCCCI)O[C@@H]2O1 |
| InChI | InChI=1S/C16H27IO6/c1-15(2)20-11-10(9-18-8-6-5-7-17)19-14-13(12(11)21-15)22-16(3,4)23-14/h10-14H,5-9H2,1-4H3/t10?,11-,12?,13?,14+/m0/s1 |
| InChIKey | IMQDGARDVVKUTE-ARDLJMPDSA-N |
| XLogP | 2.61 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|