C27H46O6 — CID 98398531
CID 98398531 (PubChem CID 98398531) has the molecular formula C27H46O6 and a molecular weight of 466.66 g/mol.
| Compound Name | CID 98398531 |
|---|---|
| PubChem CID | 98398531 |
| Molecular Formula | C27H46O6 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.33 |
| IUPAC Name | — |
| SMILES | CCCCCCCCCOC[C@H]1O[C@H]2OC3(CCCCC3)O[C@@H]2[C@H]2OC3(CCCCC3)O[C@H]21 |
| InChI | InChI=1S/C27H46O6/c1-2-3-4-5-6-7-14-19-28-20-21-22-23(31-26(30-22)15-10-8-11-16-26)24-25(29-21)33-27(32-24)17-12-9-13-18-27/h21-25H,2-20H2,1H3/t21-,22+,23+,24-,25+/m1/s1 |
| InChIKey | HHHLULUHBGEEKM-MQZWXTIWSA-N |
| XLogP | 6.00 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|