C23H42ClNO7 — CID 82017505
4-butyl-4-[3-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]propyl]morpholin-4-ium chloride (PubChem CID 82017505) has the molecular formula C23H42ClNO7 and a molecular weight of 480.04 g/mol. Its IUPAC name is 4-butyl-4-[3-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]propyl]morpholin-4-ium chloride.
| Compound Name | 4-butyl-4-[3-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]propyl]morpholin-4-ium chloride |
|---|---|
| PubChem CID | 82017505 |
| Molecular Formula | C23H42ClNO7 |
| Molecular Weight | 480.04 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | 4-butyl-4-[3-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]propyl]morpholin-4-ium chloride |
| SMILES | CCCC[N+]1(CCCOC[C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]3OC(C)(C)O[C@H]32)CCOCC1.[Cl-] |
| InChI | InChI=1S/C23H42NO7.ClH/c1-6-7-9-24(11-14-25-15-12-24)10-8-13-26-16-17-18-19(29-22(2,3)28-18)20-21(27-17)31-23(4,5)30-20;/h17-21H,6-16H2,1-5H3;1H/q+1;/p-1/t17-,18+,19+,20-,21-;/m1./s1 |
| InChIKey | ARJFCRCTRWTJDI-VYVMHGPMSA-M |
| XLogP | -0.56 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.04 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|