C21H29NO7 — CID 18804201
N-[2-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]ethyl]benzamide (PubChem CID 18804201) has the molecular formula C21H29NO7 and a molecular weight of 407.46 g/mol. Its IUPAC name is N-[2-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]ethyl]benzamide.
| Compound Name | N-[2-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 18804201 |
| Molecular Formula | C21H29NO7 |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | N-[2-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]ethyl]benzamide |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](COCCNC(=O)c1ccccc1)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C21H29NO7/c1-20(2)26-15-14(25-19-17(16(15)27-20)28-21(3,4)29-19)12-24-11-10-22-18(23)13-8-6-5-7-9-13/h5-9,14-17,19H,10-12H2,1-4H3,(H,22,23)/t14-,15+,16+,17-,19-/m1/s1 |
| InChIKey | XLGGBZSLDANENR-DIKXUDHVSA-N |
| XLogP | 1.83 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|