C23H32N2O8 — CID 5087673
N-[2-oxo-2-[2-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)methoxy]ethylamino]ethyl]benzamide (PubChem CID 5087673) has the molecular formula C23H32N2O8 and a molecular weight of 464.52 g/mol. Its IUPAC name is N-[2-oxo-2-[2-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)methoxy]ethylamino]ethyl]benzamide.
| Compound Name | N-[2-oxo-2-[2-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)methoxy]ethylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 5087673 |
| Molecular Formula | C23H32N2O8 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | N-[2-oxo-2-[2-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)methoxy]ethylamino]ethyl]benzamide |
| SMILES | CC1(C)OC2OC(COCCNC(=O)CNC(=O)c3ccccc3)C3OC(C)(C)OC3C2O1 |
| InChI | InChI=1S/C23H32N2O8/c1-22(2)30-17-15(29-21-19(18(17)31-22)32-23(3,4)33-21)13-28-11-10-24-16(26)12-25-20(27)14-8-6-5-7-9-14/h5-9,15,17-19,21H,10-13H2,1-4H3,(H,24,26)(H,25,27) |
| InChIKey | GLTZPXWGTVVDHV-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|