C19H24N2O7 — CID 124718329
(1R,2R,6S,8S,9R)-N'-benzoyl-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbohydrazide (PubChem CID 124718329) has the molecular formula C19H24N2O7 and a molecular weight of 392.41 g/mol. Its IUPAC name is (1R,2R,6S,8S,9R)-N'-benzoyl-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbohydrazide.
| Compound Name | (1R,2R,6S,8S,9R)-N'-benzoyl-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbohydrazide |
|---|---|
| PubChem CID | 124718329 |
| Molecular Formula | C19H24N2O7 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | (1R,2R,6S,8S,9R)-N'-benzoyl-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbohydrazide |
| SMILES | CC1(C)O[C@@H]2[C@@H](O1)[C@@H](C(=O)NNC(=O)c1ccccc1)O[C@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C19H24N2O7/c1-18(2)25-11-12(26-18)14-17(28-19(3,4)27-14)24-13(11)16(23)21-20-15(22)10-8-6-5-7-9-10/h5-9,11-14,17H,1-4H3,(H,20,22)(H,21,23)/t11-,12-,13+,14-,17+/m1/s1 |
| InChIKey | BGMTWABTHDGCHS-MPZWGZMNSA-N |
| XLogP | 0.84 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|