C18H22INO6 — CID 92693577
(1S,2S,6S,8S,9R)-N-(2-iodophenyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide (PubChem CID 92693577) has the molecular formula C18H22INO6 and a molecular weight of 475.28 g/mol. Its IUPAC name is (1S,2S,6S,8S,9R)-N-(2-iodophenyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide.
| Compound Name | (1S,2S,6S,8S,9R)-N-(2-iodophenyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
|---|---|
| PubChem CID | 92693577 |
| Molecular Formula | C18H22INO6 |
| Molecular Weight | 475.28 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | (1S,2S,6S,8S,9R)-N-(2-iodophenyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
| SMILES | CC1(C)O[C@@H]2O[C@H](C(=O)Nc3ccccc3I)[C@@H]3OC(C)(C)O[C@@H]3[C@@H]2O1 |
| InChI | InChI=1S/C18H22INO6/c1-17(2)23-11-12(24-17)14-16(26-18(3,4)25-14)22-13(11)15(21)20-10-8-6-5-7-9(10)19/h5-8,11-14,16H,1-4H3,(H,20,21)/t11-,12+,13+,14+,16+/m1/s1 |
| InChIKey | JGQZRYBRVYALJY-BLDNINTCSA-N |
| XLogP | 2.63 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|