C22H31NO7 — CID 100885978
(1R,2R,6R,8R,9R)-4,4,11,11-tetramethyl-N-[2-(2-methylpropoxy)phenyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide (PubChem CID 100885978) has the molecular formula C22H31NO7 and a molecular weight of 421.49 g/mol. Its IUPAC name is (1R,2R,6R,8R,9R)-4,4,11,11-tetramethyl-N-[2-(2-methylpropoxy)phenyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide.
| Compound Name | (1R,2R,6R,8R,9R)-4,4,11,11-tetramethyl-N-[2-(2-methylpropoxy)phenyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
|---|---|
| PubChem CID | 100885978 |
| Molecular Formula | C22H31NO7 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | (1R,2R,6R,8R,9R)-4,4,11,11-tetramethyl-N-[2-(2-methylpropoxy)phenyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
| SMILES | CC(C)COc1ccccc1NC(=O)[C@@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C22H31NO7/c1-12(2)11-25-14-10-8-7-9-13(14)23-19(24)17-15-16(28-21(3,4)27-15)18-20(26-17)30-22(5,6)29-18/h7-10,12,15-18,20H,11H2,1-6H3,(H,23,24)/t15-,16-,17-,18-,20-/m1/s1 |
| InChIKey | UZPCXNBVGBXTQH-HGJKNBTDSA-N |
| XLogP | 3.06 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |