C26H35NO7 — CID 51425332
CID 51425332 (PubChem CID 51425332) has the molecular formula C26H35NO7 and a molecular weight of 473.57 g/mol.
| Compound Name | CID 51425332 |
|---|---|
| PubChem CID | 51425332 |
| Molecular Formula | C26H35NO7 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | — |
| SMILES | CCOc1ccccc1NC(=O)[C@@H]1O[C@H]2OC3(CCCCC3)O[C@@H]2[C@H]2OC3(CCCCC3)O[C@H]21 |
| InChI | InChI=1S/C26H35NO7/c1-2-29-18-12-6-5-11-17(18)27-23(28)21-19-20(32-25(31-19)13-7-3-8-14-25)22-24(30-21)34-26(33-22)15-9-4-10-16-26/h5-6,11-12,19-22,24H,2-4,7-10,13-16H2,1H3,(H,27,28)/t19-,20+,21-,22-,24+/m1/s1 |
| InChIKey | BRHCYBCSCYNYAA-NBTNLBJRSA-N |
| XLogP | 4.27 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |