C29H36N4O9S — CID 21206001
CID 21206001 (PubChem CID 21206001) has the molecular formula C29H36N4O9S and a molecular weight of 616.69 g/mol.
| Compound Name | CID 21206001 |
|---|---|
| PubChem CID | 21206001 |
| Molecular Formula | C29H36N4O9S |
| Molecular Weight | 616.69 g/mol |
| Exact Mass | 616.22 |
| IUPAC Name | — |
| SMILES | COc1cncnc1NS(=O)(=O)c1ccc(NC(=O)C2O[C@@H]3OC4(CCCCC4)O[C@@H]3[C@H]3OC4(CCCCC4)O[C@@H]23)cc1 |
| InChI | InChI=1S/C29H36N4O9S/c1-37-20-16-30-17-31-25(20)33-43(35,36)19-10-8-18(9-11-19)32-26(34)23-21-22(40-28(39-21)12-4-2-5-13-28)24-27(38-23)42-29(41-24)14-6-3-7-15-29/h8-11,16-17,21-24,27H,2-7,12-15H2,1H3,(H,32,34)(H,30,31,33)/t21-,22+,23?,24-,27-/m1/s1 |
| InChIKey | ZOWCNOCRBCTIEA-USUDRERQSA-N |
| XLogP | 3.47 |
| TPSA | 156.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.69 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |