C25H30N4O9S — CID 3835575
4,4,11,11-tetramethyl-N-[2-oxo-2-[4-(pyridin-2-ylsulfamoyl)anilino]ethyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide (PubChem CID 3835575) has the molecular formula C25H30N4O9S and a molecular weight of 562.60 g/mol. Its IUPAC name is 4,4,11,11-tetramethyl-N-[2-oxo-2-[4-(pyridin-2-ylsulfamoyl)anilino]ethyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide.
| Compound Name | 4,4,11,11-tetramethyl-N-[2-oxo-2-[4-(pyridin-2-ylsulfamoyl)anilino]ethyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
|---|---|
| PubChem CID | 3835575 |
| Molecular Formula | C25H30N4O9S |
| Molecular Weight | 562.60 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | 4,4,11,11-tetramethyl-N-[2-oxo-2-[4-(pyridin-2-ylsulfamoyl)anilino]ethyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
| SMILES | CC1(C)OC2OC(C(=O)NCC(=O)Nc3ccc(S(=O)(=O)Nc4ccccn4)cc3)C3OC(C)(C)OC3C2O1 |
| InChI | InChI=1S/C25H30N4O9S/c1-24(2)35-18-19(36-24)21-23(38-25(3,4)37-21)34-20(18)22(31)27-13-17(30)28-14-8-10-15(11-9-14)39(32,33)29-16-7-5-6-12-26-16/h5-12,18-21,23H,13H2,1-4H3,(H,26,29)(H,27,31)(H,28,30) |
| InChIKey | NEZKPXFSPBYPFW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 163.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.60 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |