C23H31N3O8 — CID 22696387
4,4,11,11-tetramethyl-N-[2-[[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide (PubChem CID 22696387) has the molecular formula C23H31N3O8 and a molecular weight of 477.51 g/mol. Its IUPAC name is 4,4,11,11-tetramethyl-N-[2-[[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide.
| Compound Name | 4,4,11,11-tetramethyl-N-[2-[[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
|---|---|
| PubChem CID | 22696387 |
| Molecular Formula | C23H31N3O8 |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 4,4,11,11-tetramethyl-N-[2-[[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
| SMILES | Cc1ccc(NC(=O)CNC(=O)CNC(=O)C2OC3OC(C)(C)OC3C3OC(C)(C)OC23)cc1 |
| InChI | InChI=1S/C23H31N3O8/c1-12-6-8-13(9-7-12)26-15(28)11-24-14(27)10-25-20(29)18-16-17(32-22(2,3)31-16)19-21(30-18)34-23(4,5)33-19/h6-9,16-19,21H,10-11H2,1-5H3,(H,24,27)(H,25,29)(H,26,28) |
| InChIKey | HWCVAEPRZYQDKX-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 133.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |