C20H27N3O9 — CID 163166028
N-hydroxy-3-[[2-[[(1S,2R,6R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl]amino]acetyl]amino]benzeneamine oxide (PubChem CID 163166028) has the molecular formula C20H27N3O9 and a molecular weight of 453.45 g/mol. Its IUPAC name is N-hydroxy-3-[[2-[[(1S,2R,6R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl]amino]acetyl]amino]benzeneamine oxide.
| Compound Name | N-hydroxy-3-[[2-[[(1S,2R,6R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl]amino]acetyl]amino]benzeneamine oxide |
|---|---|
| PubChem CID | 163166028 |
| Molecular Formula | C20H27N3O9 |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | N-hydroxy-3-[[2-[[(1S,2R,6R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl]amino]acetyl]amino]benzeneamine oxide |
| SMILES | CC1(C)O[C@H]2OC(C(=O)NCC(=O)Nc3cccc([NH+]([O-])O)c3)[C@@H]3OC(C)(C)O[C@@H]3[C@H]2O1 |
| InChI | InChI=1S/C20H27N3O9/c1-19(2)29-13-14(30-19)16-18(32-20(3,4)31-16)28-15(13)17(25)21-9-12(24)22-10-6-5-7-11(8-10)23(26)27/h5-8,13-16,18,23,26H,9H2,1-4H3,(H,21,25)(H,22,24)/t13-,14+,15?,16-,18-/m1/s1 |
| InChIKey | STKBSNCKBIJQJW-BJLQQYENSA-N |
| XLogP | -0.46 |
| TPSA | 152.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|