C21H27N3O10 — CID 40878002
(1S,2R,6S,8R,9S)-N-[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide (PubChem CID 40878002) has the molecular formula C21H27N3O10 and a molecular weight of 481.46 g/mol. Its IUPAC name is (1S,2R,6S,8R,9S)-N-[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide.
| Compound Name | (1S,2R,6S,8R,9S)-N-[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
|---|---|
| PubChem CID | 40878002 |
| Molecular Formula | C21H27N3O10 |
| Molecular Weight | 481.46 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | (1S,2R,6S,8R,9S)-N-[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
| SMILES | COc1ccc(NC(=O)CNC(=O)[C@@H]2O[C@H]3OC(C)(C)O[C@@H]3[C@H]3OC(C)(C)O[C@@H]32)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H27N3O10/c1-20(2)31-14-15(32-20)17-19(34-21(3,4)33-17)30-16(14)18(26)22-9-13(25)23-11-7-6-10(29-5)8-12(11)24(27)28/h6-8,14-17,19H,9H2,1-5H3,(H,22,26)(H,23,25)/t14-,15-,16+,17+,19-/m0/s1 |
| InChIKey | GWUWDJLWRPSZHT-NRUGXNMXSA-N |
| XLogP | 1.05 |
| TPSA | 156.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.46 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|