C11H12F3N3O4 — CID 78915263
N-(4-methoxy-2-nitrophenyl)-2-(2,2,2-trifluoroethylamino)acetamide (PubChem CID 78915263) has the molecular formula C11H12F3N3O4 and a molecular weight of 307.23 g/mol. Its IUPAC name is N-(4-methoxy-2-nitrophenyl)-2-(2,2,2-trifluoroethylamino)acetamide.
| Compound Name | N-(4-methoxy-2-nitrophenyl)-2-(2,2,2-trifluoroethylamino)acetamide |
|---|---|
| PubChem CID | 78915263 |
| Molecular Formula | C11H12F3N3O4 |
| Molecular Weight | 307.23 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | N-(4-methoxy-2-nitrophenyl)-2-(2,2,2-trifluoroethylamino)acetamide |
| SMILES | COc1ccc(NC(=O)CNCC(F)(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H12F3N3O4/c1-21-7-2-3-8(9(4-7)17(19)20)16-10(18)5-15-6-11(12,13)14/h2-4,15H,5-6H2,1H3,(H,16,18) |
| InChIKey | IVNJTXVNYGSHMG-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.23 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|