C18H17F3N4O5 — CID 37175471
2-[4-acetamido-2-(trifluoromethyl)anilino]-N-(4-methoxy-2-nitrophenyl)acetamide (PubChem CID 37175471) has the molecular formula C18H17F3N4O5 and a molecular weight of 426.35 g/mol. Its IUPAC name is 2-[4-acetamido-2-(trifluoromethyl)anilino]-N-(4-methoxy-2-nitrophenyl)acetamide.
| Compound Name | 2-[4-acetamido-2-(trifluoromethyl)anilino]-N-(4-methoxy-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 37175471 |
| Molecular Formula | C18H17F3N4O5 |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 2-[4-acetamido-2-(trifluoromethyl)anilino]-N-(4-methoxy-2-nitrophenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CNc2ccc(NC(C)=O)cc2C(F)(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H17F3N4O5/c1-10(26)23-11-3-5-14(13(7-11)18(19,20)21)22-9-17(27)24-15-6-4-12(30-2)8-16(15)25(28)29/h3-8,22H,9H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | HPAXXGZZHLEMEA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|