C16H20N3O5+ — CID 9103275
[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]-methyl-[(5-methylfuran-2-yl)methyl]azanium (PubChem CID 9103275) has the molecular formula C16H20N3O5+ and a molecular weight of 334.35 g/mol. Its IUPAC name is [2-(4-methoxy-2-nitroanilino)-2-oxoethyl]-methyl-[(5-methylfuran-2-yl)methyl]azanium.
| Compound Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl]-methyl-[(5-methylfuran-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 9103275 |
| Molecular Formula | C16H20N3O5+ |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl]-methyl-[(5-methylfuran-2-yl)methyl]azanium |
| SMILES | COc1ccc(NC(=O)C[NH+](C)Cc2ccc(C)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H19N3O5/c1-11-4-5-13(24-11)9-18(2)10-16(20)17-14-7-6-12(23-3)8-15(14)19(21)22/h4-8H,9-10H2,1-3H3,(H,17,20)/p+1 |
| InChIKey | QQEORUKWFIYRSH-UHFFFAOYSA-O |
| XLogP | 1.16 |
| TPSA | 99.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|